C24H26FN3O4Si — CID 10004786
(20R)-7-amino-20-ethyl-8-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione (PubChem CID 10004786) has the molecular formula C24H26FN3O4Si and a molecular weight of 467.57 g/mol. Its IUPAC name is (20R)-7-amino-20-ethyl-8-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione.
| Compound Name | (20R)-7-amino-20-ethyl-8-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10004786 |
| Molecular Formula | C24H26FN3O4Si |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (20R)-7-amino-20-ethyl-8-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)CC(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(N)c(F)c1c2[Si](C)(C)C |
| InChI | InChI=1S/C24H26FN3O4Si/c1-5-24(31)9-18(29)32-11-13-14(24)8-17-21-12(10-28(17)23(13)30)22(33(2,3)4)19-16(27-21)7-6-15(26)20(19)25/h6-8,31H,5,9-11,26H2,1-4H3/t24-/m1/s1 |
| InChIKey | SKABZFUOPULIKX-XMMPIXPASA-N |
| XLogP | 2.74 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|