C29H25N3O4 — CID 53392997
8-(benzylideneamino)-20-ethyl-20-hydroxy-10-methyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione (PubChem CID 53392997) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 8-(benzylideneamino)-20-ethyl-20-hydroxy-10-methyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione.
| Compound Name | 8-(benzylideneamino)-20-ethyl-20-hydroxy-10-methyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 53392997 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 8-(benzylideneamino)-20-ethyl-20-hydroxy-10-methyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
| SMILES | CCC1(O)CC(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cccc(/N=C/c3ccccc3)c1c2C |
| InChI | InChI=1S/C29H25N3O4/c1-3-29(35)13-25(33)36-16-20-21(29)12-24-27-19(15-32(24)28(20)34)17(2)26-22(10-7-11-23(26)31-27)30-14-18-8-5-4-6-9-18/h4-12,14,35H,3,13,15-16H2,1-2H3/b30-14+ |
| InChIKey | NCJYJXXLXNPIOM-AMVVHIIESA-N |
| XLogP | 4.53 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|