C24H24F2N2O4Si — CID 10004924
(20R)-20-ethyl-6,7-difluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4,6,8,10,15(21)-heptaene-14,18-dione (PubChem CID 10004924) has the molecular formula C24H24F2N2O4Si and a molecular weight of 470.55 g/mol. Its IUPAC name is (20R)-20-ethyl-6,7-difluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4,6,8,10,15(21)-heptaene-14,18-dione.
| Compound Name | (20R)-20-ethyl-6,7-difluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4,6,8,10,15(21)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10004924 |
| Molecular Formula | C24H24F2N2O4Si |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (20R)-20-ethyl-6,7-difluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4,6,8,10,15(21)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)CC(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(F)cc1c2[Si](C)(C)C |
| InChI | InChI=1S/C24H24F2N2O4Si/c1-5-24(31)9-20(29)32-11-14-15(24)7-19-21-13(10-28(19)23(14)30)22(33(2,3)4)12-6-16(25)17(26)8-18(12)27-21/h6-8,31H,5,9-11H2,1-4H3/t24-/m1/s1 |
| InChIKey | KEFHIBQREDLPIG-XMMPIXPASA-N |
| XLogP | 3.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|