C24H25FN2O4Si — CID 10026884
(20R)-20-ethyl-6-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione (PubChem CID 10026884) has the molecular formula C24H25FN2O4Si and a molecular weight of 452.56 g/mol. Its IUPAC name is (20R)-20-ethyl-6-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione.
| Compound Name | (20R)-20-ethyl-6-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10026884 |
| Molecular Formula | C24H25FN2O4Si |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (20R)-20-ethyl-6-fluoro-20-hydroxy-10-trimethylsilyl-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)CC(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)ccc1c2[Si](C)(C)C |
| InChI | InChI=1S/C24H25FN2O4Si/c1-5-24(30)10-20(28)31-12-16-17(24)9-19-21-15(11-27(19)23(16)29)22(32(2,3)4)14-7-6-13(25)8-18(14)26-21/h6-9,30H,5,10-12H2,1-4H3/t24-/m1/s1 |
| InChIKey | AQIKMFYRCYCKAF-XMMPIXPASA-N |
| XLogP | 3.15 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|