C24H23N3O3S — CID 176640121
20-amino-11-ethyl-11-hydroxy-5-sulfanylidene-8-oxa-4,16-diazahexacyclo[15.7.1.02,15.04,14.06,12.021,25]pentacosa-1,6(12),13,15,17(25),18,20-heptaen-9-one (PubChem CID 176640121) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 20-amino-11-ethyl-11-hydroxy-5-sulfanylidene-8-oxa-4,16-diazahexacyclo[15.7.1.02,15.04,14.06,12.021,25]pentacosa-1,6(12),13,15,17(25),18,20-heptaen-9-one.
| Compound Name | 20-amino-11-ethyl-11-hydroxy-5-sulfanylidene-8-oxa-4,16-diazahexacyclo[15.7.1.02,15.04,14.06,12.021,25]pentacosa-1,6(12),13,15,17(25),18,20-heptaen-9-one |
|---|---|
| PubChem CID | 176640121 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 20-amino-11-ethyl-11-hydroxy-5-sulfanylidene-8-oxa-4,16-diazahexacyclo[15.7.1.02,15.04,14.06,12.021,25]pentacosa-1,6(12),13,15,17(25),18,20-heptaen-9-one |
| SMILES | CCC1(O)CC(=O)OCc2c1cc1n(c2=S)Cc2c-1nc1ccc(N)c3c1c2CCC3 |
| InChI | InChI=1S/C24H23N3O3S/c1-2-24(29)9-20(28)30-11-15-16(24)8-19-22-14(10-27(19)23(15)31)12-4-3-5-13-17(25)6-7-18(26-22)21(12)13/h6-8,29H,2-5,9-11,25H2,1H3 |
| InChIKey | NOSJPHZKQAIVHZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|