C7H17NO7P2 — CID 57318893
(7-amino-2-oxo-1-phosphonoheptyl)phosphonic acid (PubChem CID 57318893) has the molecular formula C7H17NO7P2 and a molecular weight of 289.16 g/mol. Its IUPAC name is (7-amino-2-oxo-1-phosphonoheptyl)phosphonic acid.
| Compound Name | (7-amino-2-oxo-1-phosphonoheptyl)phosphonic acid |
|---|---|
| PubChem CID | 57318893 |
| Molecular Formula | C7H17NO7P2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (7-amino-2-oxo-1-phosphonoheptyl)phosphonic acid |
| SMILES | NCCCCCC(=O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H17NO7P2/c8-5-3-1-2-4-6(9)7(16(10,11)12)17(13,14)15/h7H,1-5,8H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | CPVZPELYHQTTHF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|