C21H20F3NO8 — CID 57320231
carboxy (2S)-5-[2-[[(2R)-2-hydroxy-2-[2-(trifluoromethoxy)phenyl]ethyl]amino]propyl]-1,3-benzodioxole-2-carboxylate (PubChem CID 57320231) has the molecular formula C21H20F3NO8 and a molecular weight of 471.38 g/mol. Its IUPAC name is carboxy (2S)-5-[2-[[(2R)-2-hydroxy-2-[2-(trifluoromethoxy)phenyl]ethyl]amino]propyl]-1,3-benzodioxole-2-carboxylate.
| Compound Name | carboxy (2S)-5-[2-[[(2R)-2-hydroxy-2-[2-(trifluoromethoxy)phenyl]ethyl]amino]propyl]-1,3-benzodioxole-2-carboxylate |
|---|---|
| PubChem CID | 57320231 |
| Molecular Formula | C21H20F3NO8 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | carboxy (2S)-5-[2-[[(2R)-2-hydroxy-2-[2-(trifluoromethoxy)phenyl]ethyl]amino]propyl]-1,3-benzodioxole-2-carboxylate |
| SMILES | CC(Cc1ccc2c(c1)O[C@@H](C(=O)OC(=O)O)O2)NC[C@H](O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C21H20F3NO8/c1-11(25-10-14(26)13-4-2-3-5-15(13)33-21(22,23)24)8-12-6-7-16-17(9-12)31-19(30-16)18(27)32-20(28)29/h2-7,9,11,14,19,25-26H,8,10H2,1H3,(H,28,29)/t11?,14-,19-/m0/s1 |
| InChIKey | RUWGXYNRRXCGMP-MMNKHWDLSA-N |
| XLogP | 3.16 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|