C22H42O4 — CID 57321159
methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate (PubChem CID 57321159) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate.
| Compound Name | methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate |
|---|---|
| PubChem CID | 57321159 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate |
| SMILES | CCCCCC(O)CC[C@H]1CCC[C@@H]1CC(C)CCC(O)CC(=O)OC |
| InChI | InChI=1S/C22H42O4/c1-4-5-6-10-20(23)14-12-18-8-7-9-19(18)15-17(2)11-13-21(24)16-22(25)26-3/h17-21,23-24H,4-16H2,1-3H3/t17?,18-,19-,20?,21?/m1/s1 |
| InChIKey | YLHVCOATZVNWFX-VAOVLXHWSA-N |
| XLogP | 4.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|