About methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate
methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate (PubChem CID 57321159) has the molecular formula C22H42O4
and a molecular weight of 370.57 g/mol. Its IUPAC name is methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate |
| PubChem CID | 57321159 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate |
| SMILES | CCCCCC(O)CC[C@H]1CCC[C@@H]1CC(C)CCC(O)CC(=O)OC |
| InChI | InChI=1S/C22H42O4/c1-4-5-6-10-20(23)14-12-18-8-7-9-19(18)15-17(2)11-13-21(24)16-22(25)26-3/h17-21,23-24H,4-16H2,1-3H3/t17?,18-,19-,20?,21?/m1/s1 |
| InChIKey | YLHVCOATZVNWFX-VAOVLXHWSA-N |
| XLogP | 4.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate?
The IUPAC name of methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate (CID 57321159) is methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate.
What is the SMILES notation for methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate?
The canonical SMILES for methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate is CCCCCC(O)CC[C@H]1CCC[C@@H]1CC(C)CCC(O)CC(=O)OC.
What is the InChIKey of methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate?
The InChIKey is YLHVCOATZVNWFX-VAOVLXHWSA-N. The full InChI is InChI=1S/C22H42O4/c1-4-5-6-10-20(23)14-12-18-8-7-9-19(18)15-17(2)11-13-21(24)16-22(25)26-3/h17-21,23-24H,4-16H2,1-3H3/t17?,18-,19-,20?,21?/m1/s1.
What are the key properties of methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate?
methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate has a molecular weight of 370.57 g/mol, XLogP of 4.85, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-7-[(1R,2R)-2-(3-hydroxyoctyl)cyclopentyl]-6-methylheptanoate is sourced from PubChem (CID 57321159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).