C8H14N2O4 — CID 57321719
(2R)-2,5-diamino-5-oxo-2-propanoylpentanoic acid (PubChem CID 57321719) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is (2R)-2,5-diamino-5-oxo-2-propanoylpentanoic acid.
| Compound Name | (2R)-2,5-diamino-5-oxo-2-propanoylpentanoic acid |
|---|---|
| PubChem CID | 57321719 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2R)-2,5-diamino-5-oxo-2-propanoylpentanoic acid |
| SMILES | CCC(=O)[C@](N)(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N2O4/c1-2-5(11)8(10,7(13)14)4-3-6(9)12/h2-4,10H2,1H3,(H2,9,12)(H,13,14)/t8-/m1/s1 |
| InChIKey | UZMNSARYLZPNTH-MRVPVSSYSA-N |
| XLogP | -0.99 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|