C12H16N2 — CID 57322912
6a,9,10,10a,11,11a-hexahydro-6H-pyrazino[1,2-b]isoquinoline (PubChem CID 57322912) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6a,9,10,10a,11,11a-hexahydro-6H-pyrazino[1,2-b]isoquinoline.
| Compound Name | 6a,9,10,10a,11,11a-hexahydro-6H-pyrazino[1,2-b]isoquinoline |
|---|---|
| PubChem CID | 57322912 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6a,9,10,10a,11,11a-hexahydro-6H-pyrazino[1,2-b]isoquinoline |
| SMILES | C1=CC2CN3C=CN=CC3CC2CC1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-9-14-6-5-13-8-12(14)7-10(11)3-1/h2,4-6,8,10-12H,1,3,7,9H2 |
| InChIKey | HECGLXLLHTWDCA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|