About 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid
3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 57322933) has the molecular formula C10H8BrNO3
and a molecular weight of 270.08 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid.
Analyze 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 57322933) is 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)C1C=C(c2ccccc2Br)NO1.
What is the InChIKey of 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is MJIIXOFEDMTXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO3/c11-7-4-2-1-3-6(7)8-5-9(10(13)14)15-12-8/h1-5,9,12H,(H,13,14).
What are the key properties of 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 270.08 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 57322933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).