C14H11N — CID 57322998
3-azatricyclo[9.4.0.02,7]pentadeca-1,3,6,8,10,12,14-heptaene (PubChem CID 57322998) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-azatricyclo[9.4.0.02,7]pentadeca-1,3,6,8,10,12,14-heptaene.
| Compound Name | 3-azatricyclo[9.4.0.02,7]pentadeca-1,3,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 57322998 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-azatricyclo[9.4.0.02,7]pentadeca-1,3,6,8,10,12,14-heptaene |
| SMILES | C1=CC2=CCC=NC2=c2ccccc2=C1 |
| InChI | InChI=1S/C14H11N/c1-2-9-13-11(5-1)6-3-7-12-8-4-10-15-14(12)13/h1-3,5-10H,4H2 |
| InChIKey | BWWJBSIIEDFLQT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |