C27H34N2OS — CID 57324435
1-tert-butyl-3-[4-naphthalen-1-yloxy-2,6-di(propan-2-yl)phenyl]thiourea (PubChem CID 57324435) has the molecular formula C27H34N2OS and a molecular weight of 434.65 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-naphthalen-1-yloxy-2,6-di(propan-2-yl)phenyl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-naphthalen-1-yloxy-2,6-di(propan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 57324435 |
| Molecular Formula | C27H34N2OS |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-tert-butyl-3-[4-naphthalen-1-yloxy-2,6-di(propan-2-yl)phenyl]thiourea |
| SMILES | CC(C)c1cc(Oc2cccc3ccccc23)cc(C(C)C)c1NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C27H34N2OS/c1-17(2)22-15-20(30-24-14-10-12-19-11-8-9-13-21(19)24)16-23(18(3)4)25(22)28-26(31)29-27(5,6)7/h8-18H,1-7H3,(H2,28,29,31) |
| InChIKey | XNQOAQRYQMEWIO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|