C23H32N2OS — CID 3034380
1-tert-butyl-3-[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea (PubChem CID 3034380) has the molecular formula C23H32N2OS and a molecular weight of 384.59 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 3034380 |
| Molecular Formula | C23H32N2OS |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-tert-butyl-3-[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C23H32N2OS/c1-15(2)19-13-18(26-17-11-9-8-10-12-17)14-20(16(3)4)21(19)24-22(27)25-23(5,6)7/h8-16H,1-7H3,(H2,24,25,27) |
| InChIKey | WOWBFOBYOAGEEA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|