C25H34N2O3S — CID 178072113
ethyl 4-[[4-phenoxy-2,6-di(propan-2-yl)phenyl]carbamothioylamino]butanoate (PubChem CID 178072113) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is ethyl 4-[[4-phenoxy-2,6-di(propan-2-yl)phenyl]carbamothioylamino]butanoate.
| Compound Name | ethyl 4-[[4-phenoxy-2,6-di(propan-2-yl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 178072113 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | ethyl 4-[[4-phenoxy-2,6-di(propan-2-yl)phenyl]carbamothioylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=S)Nc1c(C(C)C)cc(Oc2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C25H34N2O3S/c1-6-29-23(28)13-10-14-26-25(31)27-24-21(17(2)3)15-20(16-22(24)18(4)5)30-19-11-8-7-9-12-19/h7-9,11-12,15-18H,6,10,13-14H2,1-5H3,(H2,26,27,31) |
| InChIKey | IDENMBCQLKZCCG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|