C17H22N4O2S2 — CID 4202455
ethyl 4-[[1-(phenylsulfanylmethyl)pyrazol-4-yl]carbamothioylamino]butanoate (PubChem CID 4202455) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is ethyl 4-[[1-(phenylsulfanylmethyl)pyrazol-4-yl]carbamothioylamino]butanoate.
| Compound Name | ethyl 4-[[1-(phenylsulfanylmethyl)pyrazol-4-yl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4202455 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl 4-[[1-(phenylsulfanylmethyl)pyrazol-4-yl]carbamothioylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=S)Nc1cnn(CSc2ccccc2)c1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-2-23-16(22)9-6-10-18-17(24)20-14-11-19-21(12-14)13-25-15-7-4-3-5-8-15/h3-5,7-8,11-12H,2,6,9-10,13H2,1H3,(H2,18,20,24) |
| InChIKey | RCDYGQCPJQORFC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|