C18H14N2O5 — CID 57326035
4,5,14-trimethoxy-9,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione (PubChem CID 57326035) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4,5,14-trimethoxy-9,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione.
| Compound Name | 4,5,14-trimethoxy-9,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
|---|---|
| PubChem CID | 57326035 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4,5,14-trimethoxy-9,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
| SMILES | COc1ccc2c(n1)C(=O)c1c-2[nH]c(=O)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C18H14N2O5/c1-23-11-6-9-10(7-12(11)24-2)18(22)20-15-8-4-5-13(25-3)19-16(8)17(21)14(9)15/h4-7H,1-3H3,(H,20,22) |
| InChIKey | PCERVHUXILLHSC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |