C22H22Br2F2N4O4S2 — CID 57326406
(2E)-3-(3-bromo-4-fluorophenyl)-N-[2-[2-[[(2E)-3-(3-bromo-4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 57326406) has the molecular formula C22H22Br2F2N4O4S2 and a molecular weight of 668.38 g/mol. Its IUPAC name is (2E)-3-(3-bromo-4-fluorophenyl)-N-[2-[2-[[(2E)-3-(3-bromo-4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(3-bromo-4-fluorophenyl)-N-[2-[2-[[(2E)-3-(3-bromo-4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 57326406 |
| Molecular Formula | C22H22Br2F2N4O4S2 |
| Molecular Weight | 668.38 g/mol |
| Exact Mass | 665.94 |
| IUPAC Name | (2E)-3-(3-bromo-4-fluorophenyl)-N-[2-[2-[[(2E)-3-(3-bromo-4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | O=C(NCCSSCCNC(=O)/C(Cc1ccc(F)c(Br)c1)=N/O)/C(Cc1ccc(F)c(Br)c1)=N/O |
| InChI | InChI=1S/C22H22Br2F2N4O4S2/c23-15-9-13(1-3-17(15)25)11-19(29-33)21(31)27-5-7-35-36-8-6-28-22(32)20(30-34)12-14-2-4-18(26)16(24)10-14/h1-4,9-10,33-34H,5-8,11-12H2,(H,27,31)(H,28,32)/b29-19+,30-20+ |
| InChIKey | KVADKHILEASNMV-CZYCKNNWSA-N |
| XLogP | 4.55 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|