C22H24F2N4O4S2 — CID 118733281
(2Z)-3-(4-fluorophenyl)-N-[2-[2-[[(2E)-3-(4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 118733281) has the molecular formula C22H24F2N4O4S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is (2Z)-3-(4-fluorophenyl)-N-[2-[2-[[(2E)-3-(4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2Z)-3-(4-fluorophenyl)-N-[2-[2-[[(2E)-3-(4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 118733281 |
| Molecular Formula | C22H24F2N4O4S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (2Z)-3-(4-fluorophenyl)-N-[2-[2-[[(2E)-3-(4-fluorophenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | O=C(NCCSSCCNC(=O)/C(Cc1ccc(F)cc1)=N/O)/C(Cc1ccc(F)cc1)=N\O |
| InChI | InChI=1S/C22H24F2N4O4S2/c23-17-5-1-15(2-6-17)13-19(27-31)21(29)25-9-11-33-34-12-10-26-22(30)20(28-32)14-16-3-7-18(24)8-4-16/h1-8,31-32H,9-14H2,(H,25,29)(H,26,30)/b27-19-,28-20+ |
| InChIKey | OGTDVWHHMIDAPH-RIRMOVKSSA-N |
| XLogP | 3.02 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|