C24H24F6N4O4S2 — CID 155537700
(2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]ethyldisulfanyl]ethyl]-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 155537700) has the molecular formula C24H24F6N4O4S2 and a molecular weight of 610.60 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]ethyldisulfanyl]ethyl]-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]ethyldisulfanyl]ethyl]-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 155537700 |
| Molecular Formula | C24H24F6N4O4S2 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]ethyldisulfanyl]ethyl]-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(NCCSSCCNC(=O)/C(Cc1cccc(C(F)(F)F)c1)=N/O)/C(Cc1cccc(C(F)(F)F)c1)=N/O |
| InChI | InChI=1S/C24H24F6N4O4S2/c25-23(26,27)17-5-1-3-15(11-17)13-19(33-37)21(35)31-7-9-39-40-10-8-32-22(36)20(34-38)14-16-4-2-6-18(12-16)24(28,29)30/h1-6,11-12,37-38H,7-10,13-14H2,(H,31,35)(H,32,36)/b33-19+,34-20+ |
| InChIKey | ZKXGGMLAOLTJLF-ZXHXELASSA-N |
| XLogP | 4.78 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|