C37H41N3O6 — CID 57329406
[(1R,2S,10R,12R,13S)-12-cyano-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-10-yl]methyl (E)-3-(4-ethylphenyl)prop-2-enoate (PubChem CID 57329406) has the molecular formula C37H41N3O6 and a molecular weight of 623.75 g/mol. Its IUPAC name is [(1R,2S,10R,12R,13S)-12-cyano-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-10-yl]methyl (E)-3-(4-ethylphenyl)prop-2-enoate.
| Compound Name | [(1R,2S,10R,12R,13S)-12-cyano-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-10-yl]methyl (E)-3-(4-ethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 57329406 |
| Molecular Formula | C37H41N3O6 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | [(1R,2S,10R,12R,13S)-12-cyano-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-10-yl]methyl (E)-3-(4-ethylphenyl)prop-2-enoate |
| SMILES | CCc1ccc(/C=C/C(=O)OC[C@H]2c3cc(OC)c(OC)cc3C[C@H]3[C@H]4c5cc(OC)c(OC)cc5C[C@@H]([C@H](C#N)N23)N4C)cc1 |
| InChI | InChI=1S/C37H41N3O6/c1-7-22-8-10-23(11-9-22)12-13-36(41)46-21-31-26-18-34(44-5)32(42-3)16-24(26)15-29-37-27-19-35(45-6)33(43-4)17-25(27)14-28(39(37)2)30(20-38)40(29)31/h8-13,16-19,28-31,37H,7,14-15,21H2,1-6H3/b13-12+/t28-,29-,30-,31-,37+/m0/s1 |
| InChIKey | NTHVZKFJQPHLAD-BXGKOTLKSA-N |
| XLogP | 5.31 |
| TPSA | 93.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|