C25H31N3O5 — CID 71653484
(1R,2S,10R,13S)-10-(aminomethyl)-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-12-one (PubChem CID 71653484) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (1R,2S,10R,13S)-10-(aminomethyl)-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-12-one.
| Compound Name | (1R,2S,10R,13S)-10-(aminomethyl)-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-12-one |
|---|---|
| PubChem CID | 71653484 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (1R,2S,10R,13S)-10-(aminomethyl)-6,7,17,18-tetramethoxy-21-methyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15,17,19-hexaen-12-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1[C@@H]3Cc4cc(OC)c(OC)cc4[C@H](CN)N3C(=O)[C@H](C2)N1C |
| InChI | InChI=1S/C25H31N3O5/c1-27-18-7-14-9-21(31-3)23(33-5)11-16(14)24(27)17-6-13-8-20(30-2)22(32-4)10-15(13)19(12-26)28(17)25(18)29/h8-11,17-19,24H,6-7,12,26H2,1-5H3/t17-,18-,19-,24+/m0/s1 |
| InChIKey | JSTWPSLKUURUMN-GSRZOBFVSA-N |
| XLogP | 2.09 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |