C15H22N3OS+ — CID 57331409
trimethyl-[3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propyl]azanium (PubChem CID 57331409) has the molecular formula C15H22N3OS+ and a molecular weight of 292.43 g/mol. Its IUPAC name is trimethyl-[3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propyl]azanium.
| Compound Name | trimethyl-[3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propyl]azanium |
|---|---|
| PubChem CID | 57331409 |
| Molecular Formula | C15H22N3OS+ |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | trimethyl-[3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propyl]azanium |
| SMILES | CSc1nc2ccccc2c(=O)n1CCC[N+](C)(C)C |
| InChI | InChI=1S/C15H22N3OS/c1-18(2,3)11-7-10-17-14(19)12-8-5-6-9-13(12)16-15(17)20-4/h5-6,8-9H,7,10-11H2,1-4H3/q+1 |
| InChIKey | YEVWZOSXKVEUJF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|