C26H36O10 — CID 57332766
(2R,3R,4S,5S,6R)-2-[(3S,5S)-1-(3,4-dihydroxyphenyl)-5-hydroxy-7-(4-methoxyphenyl)heptan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 57332766) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3S,5S)-1-(3,4-dihydroxyphenyl)-5-hydroxy-7-(4-methoxyphenyl)heptan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3S,5S)-1-(3,4-dihydroxyphenyl)-5-hydroxy-7-(4-methoxyphenyl)heptan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57332766 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3S,5S)-1-(3,4-dihydroxyphenyl)-5-hydroxy-7-(4-methoxyphenyl)heptan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(CC[C@H](O)C[C@H](CCc2ccc(O)c(O)c2)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H36O10/c1-34-18-8-3-15(4-9-18)2-7-17(28)13-19(10-5-16-6-11-20(29)21(30)12-16)35-26-25(33)24(32)23(31)22(14-27)36-26/h3-4,6,8-9,11-12,17,19,22-33H,2,5,7,10,13-14H2,1H3/t17-,19-,22+,23+,24-,25+,26+/m0/s1 |
| InChIKey | IAHHUZJSYCJVQE-MCXHVSNESA-N |
| XLogP | 0.61 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|