C24H32O10 — CID 162855719
(2S,3R,4S,5R)-2-[(3S,5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 162855719) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(3S,5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(3S,5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 162855719 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(3S,5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | Oc1ccc(CC[C@H](O)C[C@H](CCc2ccc(O)c(O)c2)O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C24H32O10/c25-15(5-1-13-3-7-17(26)19(28)9-13)11-16(6-2-14-4-8-18(27)20(29)10-14)34-24-23(32)22(31)21(30)12-33-24/h3-4,7-10,15-16,21-32H,1-2,5-6,11-12H2/t15-,16-,21+,22-,23+,24-/m0/s1 |
| InChIKey | YADPIIYIQKBQFD-CVQDTCRUSA-N |
| XLogP | 0.65 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|