C25H38N4O2 — CID 57335339
1-[(3-tert-butyl-1-hexylpyrazol-5-yl)methyl]-3-(7-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 57335339) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1-hexylpyrazol-5-yl)methyl]-3-(7-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[(3-tert-butyl-1-hexylpyrazol-5-yl)methyl]-3-(7-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 57335339 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 1-[(3-tert-butyl-1-hexylpyrazol-5-yl)methyl]-3-(7-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | CCCCCCn1nc(C(C)(C)C)cc1CNC(=O)NC1CCCc2ccc(O)cc21 |
| InChI | InChI=1S/C25H38N4O2/c1-5-6-7-8-14-29-19(15-23(28-29)25(2,3)4)17-26-24(31)27-22-11-9-10-18-12-13-20(30)16-21(18)22/h12-13,15-16,22,30H,5-11,14,17H2,1-4H3,(H2,26,27,31) |
| InChIKey | FNOBYWOKDTZUPM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|