C18H11F3N2O6 — CID 57335738
(4-nitrophenyl)methyl N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamate (PubChem CID 57335738) has the molecular formula C18H11F3N2O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamate |
|---|---|
| PubChem CID | 57335738 |
| Molecular Formula | C18H11F3N2O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (4-nitrophenyl)methyl N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamate |
| SMILES | O=C(Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11F3N2O6/c19-18(20,21)14-8-16(24)29-15-7-11(3-6-13(14)15)22-17(25)28-9-10-1-4-12(5-2-10)23(26)27/h1-8H,9H2,(H,22,25) |
| InChIKey | NLIDVIOXPDOAKB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|