C22H15FN6O5 — CID 57335864
4-[[2-[(4-fluorophenyl)carbamoylamino]-6-nitroquinazolin-4-yl]amino]benzoic acid (PubChem CID 57335864) has the molecular formula C22H15FN6O5 and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-[[2-[(4-fluorophenyl)carbamoylamino]-6-nitroquinazolin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[(4-fluorophenyl)carbamoylamino]-6-nitroquinazolin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 57335864 |
| Molecular Formula | C22H15FN6O5 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4-[[2-[(4-fluorophenyl)carbamoylamino]-6-nitroquinazolin-4-yl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1nc(Nc2ccc(C(=O)O)cc2)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C22H15FN6O5/c23-13-3-7-15(8-4-13)25-22(32)28-21-26-18-10-9-16(29(33)34)11-17(18)19(27-21)24-14-5-1-12(2-6-14)20(30)31/h1-11H,(H,30,31)(H3,24,25,26,27,28,32) |
| InChIKey | LFXDXBNGKWOQKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|