C22H17N5O5 — CID 54581485
2-[[6-nitro-2-(4-phenoxyanilino)quinazolin-4-yl]amino]acetic acid (PubChem CID 54581485) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-[[6-nitro-2-(4-phenoxyanilino)quinazolin-4-yl]amino]acetic acid.
| Compound Name | 2-[[6-nitro-2-(4-phenoxyanilino)quinazolin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 54581485 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[[6-nitro-2-(4-phenoxyanilino)quinazolin-4-yl]amino]acetic acid |
| SMILES | O=C(O)CNc1nc(Nc2ccc(Oc3ccccc3)cc2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H17N5O5/c28-20(29)13-23-21-18-12-15(27(30)31)8-11-19(18)25-22(26-21)24-14-6-9-17(10-7-14)32-16-4-2-1-3-5-16/h1-12H,13H2,(H,28,29)(H2,23,24,25,26) |
| InChIKey | AGJSYQZIWDNGQH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|