C26H30N6O4 — CID 174648586
4-[[2-(4-cyclohexyl-2-methylpiperazin-1-yl)-6-nitroquinazolin-4-yl]amino]benzoic acid (PubChem CID 174648586) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-[[2-(4-cyclohexyl-2-methylpiperazin-1-yl)-6-nitroquinazolin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[2-(4-cyclohexyl-2-methylpiperazin-1-yl)-6-nitroquinazolin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 174648586 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 4-[[2-(4-cyclohexyl-2-methylpiperazin-1-yl)-6-nitroquinazolin-4-yl]amino]benzoic acid |
| SMILES | CC1CN(C2CCCCC2)CCN1c1nc(Nc2ccc(C(=O)O)cc2)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C26H30N6O4/c1-17-16-30(20-5-3-2-4-6-20)13-14-31(17)26-28-23-12-11-21(32(35)36)15-22(23)24(29-26)27-19-9-7-18(8-10-19)25(33)34/h7-12,15,17,20H,2-6,13-14,16H2,1H3,(H,33,34)(H,27,28,29) |
| InChIKey | AOPXERLNCRTCQO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|