C27H32O4Si — CID 57336995
(Z)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxyphenyl)naphthalen-2-yl]prop-2-enal (PubChem CID 57336995) has the molecular formula C27H32O4Si and a molecular weight of 448.64 g/mol. Its IUPAC name is (Z)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxyphenyl)naphthalen-2-yl]prop-2-enal.
| Compound Name | (Z)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxyphenyl)naphthalen-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 57336995 |
| Molecular Formula | C27H32O4Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (Z)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxyphenyl)naphthalen-2-yl]prop-2-enal |
| SMILES | COc1cc(OC)cc(-c2cc3ccccc3c(O[Si](C)(C)C(C)(C)C)c2/C=C\C=O)c1 |
| InChI | InChI=1S/C27H32O4Si/c1-27(2,3)32(6,7)31-26-23-12-9-8-11-19(23)17-25(24(26)13-10-14-28)20-15-21(29-4)18-22(16-20)30-5/h8-18H,1-7H3/b13-10- |
| InChIKey | VGVZSSIBEOHPNK-RAXLEYEMSA-N |
| XLogP | 7.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|