C30H39N5O7 — CID 57337320
N-[(3S,9S,12S,13R,16S,22S)-9,13-dimethyl-2,8,11,15,21-pentaoxo-14-oxa-1,7,10,20-tetrazatetracyclo[20.4.0.03,7.016,20]hexacosan-12-yl]benzamide (PubChem CID 57337320) has the molecular formula C30H39N5O7 and a molecular weight of 581.67 g/mol. Its IUPAC name is N-[(3S,9S,12S,13R,16S,22S)-9,13-dimethyl-2,8,11,15,21-pentaoxo-14-oxa-1,7,10,20-tetrazatetracyclo[20.4.0.03,7.016,20]hexacosan-12-yl]benzamide.
| Compound Name | N-[(3S,9S,12S,13R,16S,22S)-9,13-dimethyl-2,8,11,15,21-pentaoxo-14-oxa-1,7,10,20-tetrazatetracyclo[20.4.0.03,7.016,20]hexacosan-12-yl]benzamide |
|---|---|
| PubChem CID | 57337320 |
| Molecular Formula | C30H39N5O7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | N-[(3S,9S,12S,13R,16S,22S)-9,13-dimethyl-2,8,11,15,21-pentaoxo-14-oxa-1,7,10,20-tetrazatetracyclo[20.4.0.03,7.016,20]hexacosan-12-yl]benzamide |
| SMILES | C[C@@H]1NC(=O)[C@@H](NC(=O)c2ccccc2)[C@@H](C)OC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCCN2C(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C30H39N5O7/c1-18-27(38)33-16-8-13-22(33)28(39)34-15-7-6-12-21(34)29(40)35-17-9-14-23(35)30(41)42-19(2)24(26(37)31-18)32-25(36)20-10-4-3-5-11-20/h3-5,10-11,18-19,21-24H,6-9,12-17H2,1-2H3,(H,31,37)(H,32,36)/t18-,19+,21-,22-,23-,24-/m0/s1 |
| InChIKey | JPOGTVBMGXJTCC-ZAHROFMMSA-N |
| XLogP | 0.60 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |