C21H24O6S — CID 57339399
(4aR,6R,7S,8S,8aR)-7,8-dimethoxy-2-phenyl-6-[(R)-phenylsulfinyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 57339399) has the molecular formula C21H24O6S and a molecular weight of 404.48 g/mol. Its IUPAC name is (4aR,6R,7S,8S,8aR)-7,8-dimethoxy-2-phenyl-6-[(R)-phenylsulfinyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7S,8S,8aR)-7,8-dimethoxy-2-phenyl-6-[(R)-phenylsulfinyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 57339399 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (4aR,6R,7S,8S,8aR)-7,8-dimethoxy-2-phenyl-6-[(R)-phenylsulfinyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@H]([S@](=O)c2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C21H24O6S/c1-23-18-17-16(13-25-20(27-17)14-9-5-3-6-10-14)26-21(19(18)24-2)28(22)15-11-7-4-8-12-15/h3-12,16-21H,13H2,1-2H3/t16-,17-,18+,19+,20?,21-,28-/m1/s1 |
| InChIKey | ANYFVFWLIAUUAL-LTNPIJIBSA-N |
| XLogP | 2.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |