C16H17ClOS — CID 57342567
(1S,4R,7R)-4-(4-chlorophenyl)-6,6-dimethyl-9-oxa-5-thiatricyclo[5.3.0.01,4]dec-2-ene (PubChem CID 57342567) has the molecular formula C16H17ClOS and a molecular weight of 292.83 g/mol. Its IUPAC name is (1S,4R,7R)-4-(4-chlorophenyl)-6,6-dimethyl-9-oxa-5-thiatricyclo[5.3.0.01,4]dec-2-ene.
| Compound Name | (1S,4R,7R)-4-(4-chlorophenyl)-6,6-dimethyl-9-oxa-5-thiatricyclo[5.3.0.01,4]dec-2-ene |
|---|---|
| PubChem CID | 57342567 |
| Molecular Formula | C16H17ClOS |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (1S,4R,7R)-4-(4-chlorophenyl)-6,6-dimethyl-9-oxa-5-thiatricyclo[5.3.0.01,4]dec-2-ene |
| SMILES | CC1(C)S[C@@]2(c3ccc(Cl)cc3)C=C[C@]23COC[C@H]13 |
| InChI | InChI=1S/C16H17ClOS/c1-14(2)13-9-18-10-15(13)7-8-16(15,19-14)11-3-5-12(17)6-4-11/h3-8,13H,9-10H2,1-2H3/t13-,15-,16-/m1/s1 |
| InChIKey | PRFUQONXKCIKAH-FVQBIDKESA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|