C19H20O3 — CID 57342578
(3aS,4R,8bS)-5,7-dimethoxy-4-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan (PubChem CID 57342578) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3aS,4R,8bS)-5,7-dimethoxy-4-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan.
| Compound Name | (3aS,4R,8bS)-5,7-dimethoxy-4-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan |
|---|---|
| PubChem CID | 57342578 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3aS,4R,8bS)-5,7-dimethoxy-4-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan |
| SMILES | COc1cc(OC)c2c(c1)[C@H]1OCC[C@H]1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c1-20-13-10-15-18(16(11-13)21-2)17(12-6-4-3-5-7-12)14-8-9-22-19(14)15/h3-7,10-11,14,17,19H,8-9H2,1-2H3/t14-,17-,19-/m0/s1 |
| InChIKey | IPXPYLDRIXPRTE-FNHZYXHNSA-N |
| XLogP | 3.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |