C30H34O8 — CID 10673588
(1R,3aS,4R,8bS)-1-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]furan (PubChem CID 10673588) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is (1R,3aS,4R,8bS)-1-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]furan.
| Compound Name | (1R,3aS,4R,8bS)-1-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]furan |
|---|---|
| PubChem CID | 10673588 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (1R,3aS,4R,8bS)-1-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]furan |
| SMILES | COc1cc(OC)c2c(c1)[C@@H]1[C@@H](CO[C@H]1c1ccc(OC)c(OC)c1)[C@@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H34O8/c1-31-18-13-19-27-20(15-38-29(27)16-8-9-21(32-2)22(10-16)33-3)26(28(19)23(14-18)34-4)17-11-24(35-5)30(37-7)25(12-17)36-6/h8-14,20,26-27,29H,15H2,1-7H3/t20-,26-,27+,29-/m0/s1 |
| InChIKey | HTQPKGBCGFYTTD-JXWHJRSQSA-N |
| XLogP | 5.36 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |