C33H28BF2N11 — CID 57343616
4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-bis[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]aniline (PubChem CID 57343616) has the molecular formula C33H28BF2N11 and a molecular weight of 627.47 g/mol. Its IUPAC name is 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-bis[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]aniline.
| Compound Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-bis[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 57343616 |
| Molecular Formula | C33H28BF2N11 |
| Molecular Weight | 627.47 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-bis[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]aniline |
| SMILES | F[B-]1(F)n2cccc2C(c2ccc(N(Cc3cn(Cc4ccccn4)nn3)Cc3cn(Cc4ccccn4)nn3)cc2)=C2C=CC=[N+]21 |
| InChI | InChI=1S/C33H28BF2N11/c35-34(36)46-17-5-9-31(46)33(32-10-6-18-47(32)34)25-11-13-30(14-12-25)43(19-28-23-44(41-39-28)21-26-7-1-3-15-37-26)20-29-24-45(42-40-29)22-27-8-2-4-16-38-27/h1-18,23-24H,19-22H2 |
| InChIKey | INWWZMVMCKVKDV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|