C12H14O3 — CID 57346543
2,2-dimethyl-6-[(2S)-oxiran-2-yl]-4H-1,3-benzodioxine (PubChem CID 57346543) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(2S)-oxiran-2-yl]-4H-1,3-benzodioxine.
| Compound Name | 2,2-dimethyl-6-[(2S)-oxiran-2-yl]-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 57346543 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,2-dimethyl-6-[(2S)-oxiran-2-yl]-4H-1,3-benzodioxine |
| SMILES | CC1(C)OCc2cc([C@H]3CO3)ccc2O1 |
| InChI | InChI=1S/C12H14O3/c1-12(2)14-6-9-5-8(11-7-13-11)3-4-10(9)15-12/h3-5,11H,6-7H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZSJXKLGDRXIOAI-LLVKDONJSA-N |
| XLogP | 2.40 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|