About 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene
4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene (PubChem CID 87177123) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene.
Analyze 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene?
The IUPAC name of 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene (CID 87177123) is 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene.
What is the SMILES notation for 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene?
The canonical SMILES for 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene is CC1(C)Oc2ccc3cc2CC31.
What is the InChIKey of 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene?
The InChIKey is TZSZDWSDBDYSBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-11(2)9-6-8-5-7(9)3-4-10(8)12-11/h3-5,9H,6H2,1-2H3.
What are the key properties of 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene?
4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene has a molecular weight of 160.22 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-5-oxatricyclo[4.4.0.03,9]deca-1(6),7,9-triene is sourced from PubChem (CID 87177123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).