C18H26O — CID 57348500
2-prop-2-enyl-4-(4-propylcyclohexyl)phenol (PubChem CID 57348500) has the molecular formula C18H26O and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-prop-2-enyl-4-(4-propylcyclohexyl)phenol.
| Compound Name | 2-prop-2-enyl-4-(4-propylcyclohexyl)phenol |
|---|---|
| PubChem CID | 57348500 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-prop-2-enyl-4-(4-propylcyclohexyl)phenol |
| SMILES | C=CCc1cc(C2CCC(CCC)CC2)ccc1O |
| InChI | InChI=1S/C18H26O/c1-3-5-14-7-9-15(10-8-14)16-11-12-18(19)17(13-16)6-4-2/h4,11-15,19H,2-3,5-10H2,1H3 |
| InChIKey | MKARXFQFRHRMKB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|