C31H45F — CID 143091542
2-fluoro-4-(4-propylcyclohexyl)-1-[(2E,4E)-5-(4-propylcyclohexyl)hepta-2,4,6-trien-2-yl]benzene (PubChem CID 143091542) has the molecular formula C31H45F and a molecular weight of 436.70 g/mol. Its IUPAC name is 2-fluoro-4-(4-propylcyclohexyl)-1-[(2E,4E)-5-(4-propylcyclohexyl)hepta-2,4,6-trien-2-yl]benzene.
| Compound Name | 2-fluoro-4-(4-propylcyclohexyl)-1-[(2E,4E)-5-(4-propylcyclohexyl)hepta-2,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143091542 |
| Molecular Formula | C31H45F |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | 2-fluoro-4-(4-propylcyclohexyl)-1-[(2E,4E)-5-(4-propylcyclohexyl)hepta-2,4,6-trien-2-yl]benzene |
| SMILES | C=C/C(=C\C=C(/C)c1ccc(C2CCC(CCC)CC2)cc1F)C1CCC(CCC)CC1 |
| InChI | InChI=1S/C31H45F/c1-5-8-24-11-16-27(17-12-24)26(7-3)15-10-23(4)30-21-20-29(22-31(30)32)28-18-13-25(9-6-2)14-19-28/h7,10,15,20-22,24-25,27-28H,3,5-6,8-9,11-14,16-19H2,1-2,4H3/b23-10+,26-15+ |
| InChIKey | VHRKALRIHZZPLZ-MUFLPOBQSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|