About diheptyl(dihexyl)azanium perchlorate
diheptyl(dihexyl)azanium perchlorate (PubChem CID 57349972) has the molecular formula C26H56ClNO4
and a molecular weight of 482.19 g/mol. Its IUPAC name is diheptyl(dihexyl)azanium perchlorate.
Molecular Properties
| Compound Name | diheptyl(dihexyl)azanium perchlorate |
| PubChem CID | 57349972 |
| Molecular Formula | C26H56ClNO4 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 481.39 |
| IUPAC Name | diheptyl(dihexyl)azanium perchlorate |
| SMILES | CCCCCCC[N+](CCCCCC)(CCCCCC)CCCCCCC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H56N.ClHO4/c1-5-9-13-17-21-25-27(23-19-15-11-7-3,24-20-16-12-8-4)26-22-18-14-10-6-2;2-1(3,4)5/h5-26H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | JGMJKDLOUISAQN-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diheptyl(dihexyl)azanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diheptyl(dihexyl)azanium perchlorate?
The IUPAC name of diheptyl(dihexyl)azanium perchlorate (CID 57349972) is diheptyl(dihexyl)azanium perchlorate.
What is the SMILES notation for diheptyl(dihexyl)azanium perchlorate?
The canonical SMILES for diheptyl(dihexyl)azanium perchlorate is CCCCCCC[N+](CCCCCC)(CCCCCC)CCCCCCC.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of diheptyl(dihexyl)azanium perchlorate?
The InChIKey is JGMJKDLOUISAQN-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H56N.ClHO4/c1-5-9-13-17-21-25-27(23-19-15-11-7-3,24-20-16-12-8-4)26-22-18-14-10-6-2;2-1(3,4)5/h5-26H2,1-4H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of diheptyl(dihexyl)azanium perchlorate?
diheptyl(dihexyl)azanium perchlorate has a molecular weight of 482.19 g/mol, XLogP of 4.15, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diheptyl(dihexyl)azanium perchlorate is sourced from PubChem (CID 57349972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).