About tetrabutylazanium;perchlorate;hydrobromide
tetrabutylazanium;perchlorate;hydrobromide (PubChem CID 173079032) has the molecular formula C16H37BrClNO4
and a molecular weight of 422.83 g/mol. Its IUPAC name is tetrabutylazanium;perchlorate;hydrobromide.
Molecular Properties
| Compound Name | tetrabutylazanium;perchlorate;hydrobromide |
| PubChem CID | 173079032 |
| Molecular Formula | C16H37BrClNO4 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | tetrabutylazanium;perchlorate;hydrobromide |
| SMILES | Br.CCCC[N+](CCCC)(CCCC)CCCC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H36N.BrH.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;2-1(3,4)5/h5-16H2,1-4H3;1H;(H,2,3,4,5)/q+1;;/p-1 |
| InChIKey | NIVHEBGHZNUXSF-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;perchlorate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;perchlorate;hydrobromide?
The IUPAC name of tetrabutylazanium;perchlorate;hydrobromide (CID 173079032) is tetrabutylazanium;perchlorate;hydrobromide.
What is the SMILES notation for tetrabutylazanium;perchlorate;hydrobromide?
The canonical SMILES for tetrabutylazanium;perchlorate;hydrobromide is Br.CCCC[N+](CCCC)(CCCC)CCCC.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of tetrabutylazanium;perchlorate;hydrobromide?
The InChIKey is NIVHEBGHZNUXSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.BrH.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;2-1(3,4)5/h5-16H2,1-4H3;1H;(H,2,3,4,5)/q+1;;/p-1.
What are the key properties of tetrabutylazanium;perchlorate;hydrobromide?
tetrabutylazanium;perchlorate;hydrobromide has a molecular weight of 422.83 g/mol, XLogP of 0.83, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;perchlorate;hydrobromide is sourced from PubChem (CID 173079032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).