C24H25N5S — CID 57353009
2-(1,3-benzothiazol-2-yl)-1-cyclohexyl-1-(2-methylquinolin-4-yl)guanidine (PubChem CID 57353009) has the molecular formula C24H25N5S and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-cyclohexyl-1-(2-methylquinolin-4-yl)guanidine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-cyclohexyl-1-(2-methylquinolin-4-yl)guanidine |
|---|---|
| PubChem CID | 57353009 |
| Molecular Formula | C24H25N5S |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-cyclohexyl-1-(2-methylquinolin-4-yl)guanidine |
| SMILES | Cc1cc(N(C(N)=Nc2nc3ccccc3s2)C2CCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H25N5S/c1-16-15-21(18-11-5-6-12-19(18)26-16)29(17-9-3-2-4-10-17)23(25)28-24-27-20-13-7-8-14-22(20)30-24/h5-8,11-15,17H,2-4,9-10H2,1H3,(H2,25,27,28) |
| InChIKey | CAPGYMDBFHGEHY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|