C10H10FO2S- — CID 57353538
2-(4-fluorophenyl)sulfanylbutanoate (PubChem CID 57353538) has the molecular formula C10H10FO2S- and a molecular weight of 213.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanylbutanoate.
| Compound Name | 2-(4-fluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 57353538 |
| Molecular Formula | C10H10FO2S- |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanylbutanoate |
| SMILES | CCC(Sc1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C10H11FO2S/c1-2-9(10(12)13)14-8-5-3-7(11)4-6-8/h3-6,9H,2H2,1H3,(H,12,13)/p-1 |
| InChIKey | RXUJETLFFOEPGU-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |