About CID 57354140
CID 57354140 (PubChem CID 57354140) has the molecular formula C24H51AlO8P3+2
and a molecular weight of 587.57 g/mol.
Molecular Properties
| Compound Name | CID 57354140 |
| PubChem CID | 57354140 |
| Molecular Formula | C24H51AlO8P3+2 |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | — |
| SMILES | CCCCCCCCO[P+](=O)OP(=O)(OCCCCCCCC)O[P+](=O)OCCCCCCCC.[Al] |
| InChI | InChI=1S/C24H51O8P3.Al/c1-4-7-10-13-16-19-22-28-33(25)31-35(27,30-24-21-18-15-12-9-6-3)32-34(26)29-23-20-17-14-11-8-5-2;/h4-24H2,1-3H3;/q+2; |
| InChIKey | FDMBGKPLXBBMRA-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 57354140 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57354140?
The IUPAC name of CID 57354140 (CID 57354140) is not available.
What is the SMILES notation for CID 57354140?
The canonical SMILES for CID 57354140 is CCCCCCCCO[P+](=O)OP(=O)(OCCCCCCCC)O[P+](=O)OCCCCCCCC.[Al].
What is the InChIKey of CID 57354140?
The InChIKey is FDMBGKPLXBBMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51O8P3.Al/c1-4-7-10-13-16-19-22-28-33(25)31-35(27,30-24-21-18-15-12-9-6-3)32-34(26)29-23-20-17-14-11-8-5-2;/h4-24H2,1-3H3;/q+2;.
What are the key properties of CID 57354140?
CID 57354140 has a molecular weight of 587.57 g/mol, XLogP of 10.19, 28 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57354140 is sourced from PubChem (CID 57354140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).