C14H26O10 — CID 57354778
1-(2,2-dihydroperoxy-1-methylcyclohexyl)peroxy-2,2-dihydroperoxy-1-methylcyclohexane (PubChem CID 57354778) has the molecular formula C14H26O10 and a molecular weight of 354.35 g/mol. Its IUPAC name is 1-(2,2-dihydroperoxy-1-methylcyclohexyl)peroxy-2,2-dihydroperoxy-1-methylcyclohexane.
| Compound Name | 1-(2,2-dihydroperoxy-1-methylcyclohexyl)peroxy-2,2-dihydroperoxy-1-methylcyclohexane |
|---|---|
| PubChem CID | 57354778 |
| Molecular Formula | C14H26O10 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(2,2-dihydroperoxy-1-methylcyclohexyl)peroxy-2,2-dihydroperoxy-1-methylcyclohexane |
| SMILES | CC1(OOC2(C)CCCCC2(OO)OO)CCCCC1(OO)OO |
| InChI | InChI=1S/C14H26O10/c1-11(7-3-5-9-13(11,19-15)20-16)23-24-12(2)8-4-6-10-14(12,21-17)22-18/h15-18H,3-10H2,1-2H3 |
| InChIKey | XCWWQPUMWWTKRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|