C26H28ClN3O4 — CID 57355835
N-[(2S)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-hydroxypropan-2-yl]-3-(5-cyano-2-methoxyphenyl)prop-2-enamide (PubChem CID 57355835) has the molecular formula C26H28ClN3O4 and a molecular weight of 481.98 g/mol. Its IUPAC name is N-[(2S)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-hydroxypropan-2-yl]-3-(5-cyano-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[(2S)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-hydroxypropan-2-yl]-3-(5-cyano-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 57355835 |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[(2S)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-hydroxypropan-2-yl]-3-(5-cyano-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C#N)cc1C=CC(=O)N[C@H](CO)CN1CCC(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H28ClN3O4/c1-34-24-8-2-18(15-28)14-21(24)5-9-25(32)29-23(17-31)16-30-12-10-20(11-13-30)26(33)19-3-6-22(27)7-4-19/h2-9,14,20,23,31H,10-13,16-17H2,1H3,(H,29,32)/t23-/m0/s1 |
| InChIKey | OZNBXTNEPFNVSR-QHCPKHFHSA-N |
| XLogP | 3.31 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|