C26H28FN3O5 — CID 68576634
(3R)-3-[3-(5-cyano-2-methoxyphenyl)prop-2-enoylamino]-4-[4-(4-fluorophenoxy)piperidin-1-yl]butanoic acid (PubChem CID 68576634) has the molecular formula C26H28FN3O5 and a molecular weight of 481.52 g/mol. Its IUPAC name is (3R)-3-[3-(5-cyano-2-methoxyphenyl)prop-2-enoylamino]-4-[4-(4-fluorophenoxy)piperidin-1-yl]butanoic acid.
| Compound Name | (3R)-3-[3-(5-cyano-2-methoxyphenyl)prop-2-enoylamino]-4-[4-(4-fluorophenoxy)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68576634 |
| Molecular Formula | C26H28FN3O5 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (3R)-3-[3-(5-cyano-2-methoxyphenyl)prop-2-enoylamino]-4-[4-(4-fluorophenoxy)piperidin-1-yl]butanoic acid |
| SMILES | COc1ccc(C#N)cc1C=CC(=O)N[C@H](CC(=O)O)CN1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H28FN3O5/c1-34-24-8-2-18(16-28)14-19(24)3-9-25(31)29-21(15-26(32)33)17-30-12-10-23(11-13-30)35-22-6-4-20(27)5-7-22/h2-9,14,21,23H,10-13,15,17H2,1H3,(H,29,31)(H,32,33)/t21-/m1/s1 |
| InChIKey | PYQIOTGYARAWGK-OAQYLSRUSA-N |
| XLogP | 3.22 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|