C23H26BrFN2O3 — CID 10162640
(E)-3-(3-bromophenyl)-N-[2-[4-(4-fluorophenoxy)piperidin-1-yl]-1-methoxyethyl]prop-2-enamide (PubChem CID 10162640) has the molecular formula C23H26BrFN2O3 and a molecular weight of 477.37 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[2-[4-(4-fluorophenoxy)piperidin-1-yl]-1-methoxyethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[2-[4-(4-fluorophenoxy)piperidin-1-yl]-1-methoxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10162640 |
| Molecular Formula | C23H26BrFN2O3 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[2-[4-(4-fluorophenoxy)piperidin-1-yl]-1-methoxyethyl]prop-2-enamide |
| SMILES | COC(CN1CCC(Oc2ccc(F)cc2)CC1)NC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C23H26BrFN2O3/c1-29-23(26-22(28)10-5-17-3-2-4-18(24)15-17)16-27-13-11-21(12-14-27)30-20-8-6-19(25)7-9-20/h2-10,15,21,23H,11-14,16H2,1H3,(H,26,28)/b10-5+ |
| InChIKey | JHZZBDOWDIHRFP-BJMVGYQFSA-N |
| XLogP | 4.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|